Difference between revisions of "Tiso gene 9236"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_9236 == * right end position: ** 7286 * transcription direction: ** POSITIVE * left end position: ** 4241 * centisome position: ** 44.67502...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9236 == |
− | * | + | * right end position: |
− | ** | + | ** 7286 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4241 |
− | * | + | * centisome position: |
− | ** | + | ** 44.675022 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY66-367]] | ||
+ | * [[PWY-6174]] | ||
+ | * [[PWY-922]] | ||
+ | * [[PWY-7391]] | ||
+ | * [[PWY-7571]] | ||
+ | * [[PWY-7524]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7286}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4241}} | |
− | + | {{#set: centisome position=44.675022 }} | |
− | + | {{#set: reaction associated=HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN}} | |
− | + | {{#set: pathway associated=PWY66-367|PWY-6174|PWY-922|PWY-7391|PWY-7571|PWY-7524}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:50, 21 March 2018
Gene Tiso_gene_9236
- right end position:
- 7286
- transcription direction:
- POSITIVE
- left end position:
- 4241
- centisome position:
- 44.675022
- Synonym(s):
Reactions associated
- Reaction: HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation