Difference between revisions of "RXN-11881"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * common name: ** S-succ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11881 RXN-11881] == * direction: ** LEFT-TO-RIGHT * common name: ** 4α,14α-dimethyl...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11881 RXN-11881] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.14.13.70 EC-1.14.13.70] | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 3 [[NADPH]][c] '''+''' 1 [[CPD-12852]][c] '''+''' 2 [[PROTON]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''=>''' 4 [[WATER]][c] '''+''' 3 [[NADP]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[CPD-12853]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 3 NADPH[c] '''+''' 1 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol[c] '''+''' 2 H+[c] '''+''' 3 oxygen[c] '''=>''' 4 H2O[c] '''+''' 3 NADP+[c] '''+''' 1 formate[c] '''+''' 1 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_8263]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase}} | |
− | + | {{#set: ec number=EC-1.14.13.70}} | |
− | + | {{#set: gene associated=Tiso_gene_8263}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:50, 21 March 2018
Contents
Reaction RXN-11881
- direction:
- LEFT-TO-RIGHT
- common name:
- 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 3 NADPH[c] + 1 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol[c] + 2 H+[c] + 3 oxygen[c] => 4 H2O[c] + 3 NADP+[c] + 1 formate[c] + 1 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_8263
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus