Difference between revisions of "GDR nadp m"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_m GDR_nadp_m] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione-disulfide red...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_m GDR_nadp_m] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glutathione-disulfide reductase (NADP), mitochondria |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1.0 [[NADPH]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][m] '''=>''' 1.0 [[NADP]][m] '''+''' 2.0 [[GLUTATHIONE]][m] |
− | == | + | * With common name(s): |
+ | ** 1.0 NADPH[m] '''+''' 1.0 H+[m] '''+''' 1.0 glutathione disulfide[m] '''=>''' 1.0 NADP+[m] '''+''' 2.0 glutathione[m] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12533]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_2804]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=glutathione-disulfide reductase (NADP), mitochondria}} | |
− | + | {{#set: gene associated=Tiso_gene_12533|Tiso_gene_2804}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:50, 21 March 2018
Contents
Reaction GDR_nadp_m
- direction:
- LEFT-TO-RIGHT
- common name:
- glutathione-disulfide reductase (NADP), mitochondria
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 NADPH[m] + 1.0 PROTON[m] + 1.0 OXIDIZED-GLUTATHIONE[m] => 1.0 NADP[m] + 2.0 GLUTATHIONE[m]
- With common name(s):
- 1.0 NADPH[m] + 1.0 H+[m] + 1.0 glutathione disulfide[m] => 1.0 NADP+[m] + 2.0 glutathione[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12533
- Source: orthology-creinhardtii
- Gene: Tiso_gene_2804
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii