Difference between revisions of "GDR nadp m"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_m GDR_nadp_m] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione-disulfide red...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_m GDR_nadp_m] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
+
 
* common name:
 
* common name:
−
** glycerophosphoserine
+
** glutathione-disulfide reductase (NADP), mitochondria
−
* molecular weight:
+
−
** 258.144   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14136]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NADPH]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][m] '''=>''' 1.0 [[NADP]][m] '''+''' 2.0 [[GLUTATHIONE]][m]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NADPH[m] '''+''' 1.0 H+[m] '''+''' 1.0 glutathione disulfide[m] '''=>''' 1.0 NADP+[m] '''+''' 2.0 glutathione[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12533]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_2804]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260]
+
{{#set: common name=glutathione-disulfide reductase (NADP), mitochondria}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_12533|Tiso_gene_2804}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931]
+
{{#set: in pathway=}}
−
* BIGG : g3ps
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=glycerophosphoserine}}
+
−
{{#set: molecular weight=258.144    }}
+
−
{{#set: consumed by=RXN-14136}}
+

Latest revision as of 20:50, 21 March 2018

Reaction GDR_nadp_m

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glutathione-disulfide reductase (NADP), mitochondria
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GDR_nadp_m&oldid=44103"