Difference between revisions of "GDR nadp m"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_m GDR_nadp_m] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione-disulfide red...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp_m GDR_nadp_m] ==
−
* smiles:
+
* direction:
−
** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 3-hydroxyechinenone
+
** glutathione-disulfide reductase (NADP), mitochondria
−
* inchi key:
+
−
** InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N
+
−
* molecular weight:
+
−
** 566.865   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-4-keto-β,β-carotene
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[R07562]]
+
** 1.0 [[NADPH]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][m] '''=>''' 1.0 [[NADP]][m] '''+''' 2.0 [[GLUTATHIONE]][m]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NADPH[m] '''+''' 1.0 H+[m] '''+''' 1.0 glutathione disulfide[m] '''=>''' 1.0 NADP+[m] '''+''' 2.0 glutathione[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12533]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_2804]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10120578 10120578]
+
{{#set: common name=glutathione-disulfide reductase (NADP), mitochondria}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_12533|Tiso_gene_2804}}
−
** [http://www.chemspider.com/Chemical-Structure.8296099.html 8296099]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15966 C15966]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3-hydroxyechinenone}}
+
−
{{#set: inchi key=InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N}}
+
−
{{#set: molecular weight=566.865    }}
+
−
{{#set: common name=3-hydroxy-4-keto-β,β-carotene}}
+
−
{{#set: produced by=R07562}}
+

Latest revision as of 20:50, 21 March 2018

Reaction GDR_nadp_m

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glutathione-disulfide reductase (NADP), mitochondria
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GDR_nadp_m&oldid=44103"