Difference between revisions of "Tiso gene 16690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_16690 == * right end position: ** 4178 * transcription direction: ** POSITIVE * left end position: ** 6 * centisome position: ** 0.14360937...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
+
== Gene Tiso_gene_16690 ==
* smiles:
+
* right end position:
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
** 4178
* inchi key:
+
* transcription direction:
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
+
** POSITIVE
* common name:
+
* left end position:
** dihydrogeranylgeranyl diphosphate
+
** 6
* molecular weight:
+
* centisome position:
** 449.44    
+
** 0.14360937    
 
* Synonym(s):
 
* Synonym(s):
** dihydroGGPP
 
** dihydrogeranylgeranyl-PP
 
** dihydrogeranylgeranyl pyrophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.2.31-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-7659]]
+
*** Assignment: ec-number
* [[RXN-7658]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=4178}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: left end position=6}}
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
+
{{#set: centisome position=0.14360937   }}
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: reaction associated=2.4.2.31-RXN}}
{{#set: molecular weight=449.44   }}
+
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
+
{{#set: consumed or produced by=RXN-7659|RXN-7658}}
+

Latest revision as of 20:50, 21 March 2018

Gene Tiso_gene_16690

  • right end position:
    • 4178
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6
  • centisome position:
    • 0.14360937
  • Synonym(s):

Reactions associated

Pathways associated

External links