Difference between revisions of "CPD-14276"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * inchi key: ** InChIKey=KRKNYBC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14276 CPD-14276] == * smiles: ** CCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP(...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14276 CPD-14276] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (3R)-3-hydroxy-behenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=VNJQSRVXTRJVAZ-ZUIQSSPPSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1102.075 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (3R)-3-hydroxy-docosanoyl-CoA |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13303]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13299]] |
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193817 72193817] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76375 76375] |
− | + | {{#set: smiles=CCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} | |
− | {{#set: smiles= | + | {{#set: common name=(3R)-3-hydroxy-behenoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=VNJQSRVXTRJVAZ-ZUIQSSPPSA-J}} |
− | {{#set: | + | {{#set: molecular weight=1102.075 }} |
− | {{#set: molecular weight= | + | {{#set: common name=(3R)-3-hydroxy-docosanoyl-CoA}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-13303}} |
− | {{#set: | + | {{#set: produced by=RXN-13299}} |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite CPD-14276
- smiles:
- CCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- common name:
- (3R)-3-hydroxy-behenoyl-CoA
- inchi key:
- InChIKey=VNJQSRVXTRJVAZ-ZUIQSSPPSA-J
- molecular weight:
- 1102.075
- Synonym(s):
- (3R)-3-hydroxy-docosanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.