Difference between revisions of "3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14465 == * left end position: ** 1408 * transcription direction: ** POSITIVE * right end position: ** 5583 * centisome position: ** 24.9733...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] == * smiles: ** C(=O)(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** 3-deoxy-D-arabino-heptulosonate 7-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 285.124 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-deoxy-D-arabino-heptulosonate-7-P | ||
+ | ** 3-deoxy-arabino-heptulosonate 7-phosphate | ||
+ | ** 3-deoxy-arabino-heptulosonate-7-P | ||
+ | ** 2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate | ||
+ | ** 3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate | ||
+ | ** 3-deoxy-arabino-heptulonate 7-phosphate | ||
+ | ** DAHP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[3- | + | * [[3-DEHYDROQUINATE-SYNTHASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[DAHPSYN-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2627-73-8 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460215 5460215] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58394 58394] |
− | {{#set: | + | * BIGG : 2dda7p |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04691 C04691] | ||
+ | {{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-]}} | ||
+ | {{#set: common name=3-deoxy-D-arabino-heptulosonate 7-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K}} | ||
+ | {{#set: molecular weight=285.124 }} | ||
+ | {{#set: common name=3-deoxy-D-arabino-heptulosonate-7-P|3-deoxy-arabino-heptulosonate 7-phosphate|3-deoxy-arabino-heptulosonate-7-P|2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate|3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate|3-deoxy-arabino-heptulonate 7-phosphate|DAHP}} | ||
+ | {{#set: consumed by=3-DEHYDROQUINATE-SYNTHASE-RXN}} | ||
+ | {{#set: reversible reaction associated=DAHPSYN-RXN}} |
Latest revision as of 20:50, 21 March 2018
Contents
Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P
- smiles:
- C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-]
- common name:
- 3-deoxy-D-arabino-heptulosonate 7-phosphate
- inchi key:
- InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K
- molecular weight:
- 285.124
- Synonym(s):
- 3-deoxy-D-arabino-heptulosonate-7-P
- 3-deoxy-arabino-heptulosonate 7-phosphate
- 3-deoxy-arabino-heptulosonate-7-P
- 2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
- 3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate
- 3-deoxy-arabino-heptulonate 7-phosphate
- DAHP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.