Difference between revisions of "FNorh"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FNorh FNorh] == * direction: ** LEFT-TO-RIGHT * common name: ** ferredoxin---NADP+ reductase * Syno...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FNorh FNorh] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ferredoxin---NADP+ reductase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1.0 [[NADP]][h] '''+''' 1.0 [[Reduced-ferredoxins]][u] '''=>''' 1.0 [[NADPH]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[Oxidized-ferredoxins]][u] | |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1.0 NADP+[h] '''+''' 1.0 a reduced ferredoxin [iron-sulfur] cluster[u] '''=>''' 1.0 NADPH[h] '''+''' 1.0 H+[h] '''+''' 1.0 an oxidized ferredoxin [iron-sulfur] cluster[u] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| + | * Gene: [[Tiso_gene_20055]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | * Gene: [[Tiso_gene_8497]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | * Gene: [[Tiso_gene_20168]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | * Gene: [[Tiso_gene_4632]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=ferredoxin---NADP+ reductase}} | |
| − | + | {{#set: gene associated=Tiso_gene_20055|Tiso_gene_8497|Tiso_gene_20168|Tiso_gene_4632}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:50, 21 March 2018
Contents
Reaction FNorh
- direction:
- LEFT-TO-RIGHT
- common name:
- ferredoxin---NADP+ reductase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 NADP[h] + 1.0 Reduced-ferredoxins[u] => 1.0 NADPH[h] + 1.0 PROTON[h] + 1.0 Oxidized-ferredoxins[u]
- With common name(s):
- 1.0 NADP+[h] + 1.0 a reduced ferredoxin [iron-sulfur] cluster[u] => 1.0 NADPH[h] + 1.0 H+[h] + 1.0 an oxidized ferredoxin [iron-sulfur] cluster[u]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_20055
- Source: orthology-creinhardtii
- Gene: Tiso_gene_8497
- Source: orthology-creinhardtii
- Gene: Tiso_gene_20168
- Source: orthology-creinhardtii
- Gene: Tiso_gene_4632
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
