Difference between revisions of "CPD-15016"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NQOR-RXN NQOR-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** possible_vitamin_k_epoxide_pl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * common name: ** (4S)-4-hy...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NQOR-RXN NQOR-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(=O)C([O-])=O)C(C([O-])=O)O
 
* common name:
 
* common name:
−
** possible_vitamin_k_epoxide_plastid_protein
+
** (4S)-4-hydroxy-2-oxoglutarate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.6.5.2 EC-1.6.5.2]
+
** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
 +
* molecular weight:
 +
** 160.083   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-4-hydroxy-2-oxoglutarate
 +
** L-4-hydroxy-2-ketoglutarate
 +
** (S)-2-hydroxy-4-oxopentanedioate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ETR-Quinones]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-13990]]
−
** 1 NAD(P)H[c] '''+''' 1 H+[c] '''+''' 1 an electron-transfer quinone[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 NAD(P)+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10318]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P15559 P15559]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337]
−
** [http://www.uniprot.org/uniprot/P16083 P16083]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P05982 P05982]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685]
−
** [http://www.uniprot.org/uniprot/Q64669 Q64669]
+
* METABOLIGHTS : MTBLC71685
−
** [http://www.uniprot.org/uniprot/P0A756 P0A756]
+
{{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}}
−
** [http://www.uniprot.org/uniprot/P43340 P43340]
+
{{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}}
−
** [http://www.uniprot.org/uniprot/P0A754 P0A754]
+
{{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}}
−
** [http://www.uniprot.org/uniprot/P45245 P45245]
+
{{#set: molecular weight=160.083    }}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}}
−
{{#set: common name=possible_vitamin_k_epoxide_plastid_protein}}
+
{{#set: reversible reaction associated=RXN-13990}}
−
{{#set: ec number=EC-1.6.5.2}}
+
−
{{#set: gene associated=Tiso_gene_10318}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 19:51, 21 March 2018

Metabolite CPD-15016

  • smiles:
    • C(C(=O)C([O-])=O)C(C([O-])=O)O
  • common name:
    • (4S)-4-hydroxy-2-oxoglutarate
  • inchi key:
    • InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
  • molecular weight:
    • 160.083
  • Synonym(s):
    • L-4-hydroxy-2-oxoglutarate
    • L-4-hydroxy-2-ketoglutarate
    • (S)-2-hydroxy-4-oxopentanedioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(=O)C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15016&oldid=44164"