Difference between revisions of "CPD-15016"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucosides Beta-D-glucosides] == * common name: ** a β-D glucoside * Synonym(s): =...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * common name: ** (4S)-4-hy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucosides Beta-D-glucosides] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
 +
* smiles:
 +
** C(C(=O)C([O-])=O)C(C([O-])=O)O
 
* common name:
 
* common name:
** a β-D glucoside
+
** (4S)-4-hydroxy-2-oxoglutarate
 +
* inchi key:
 +
** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
 +
* molecular weight:
 +
** 160.083   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-4-hydroxy-2-oxoglutarate
 +
** L-4-hydroxy-2-ketoglutarate
 +
** (S)-2-hydroxy-4-oxopentanedioate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.21-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-13990]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a β-D glucoside}}
+
* PUBCHEM:
{{#set: consumed by=3.2.1.21-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685]
 +
* METABOLIGHTS : MTBLC71685
 +
{{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}}
 +
{{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}}
 +
{{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}}
 +
{{#set: molecular weight=160.083    }}
 +
{{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}}
 +
{{#set: reversible reaction associated=RXN-13990}}

Latest revision as of 19:51, 21 March 2018

Metabolite CPD-15016

  • smiles:
    • C(C(=O)C([O-])=O)C(C([O-])=O)O
  • common name:
    • (4S)-4-hydroxy-2-oxoglutarate
  • inchi key:
    • InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
  • molecular weight:
    • 160.083
  • Synonym(s):
    • L-4-hydroxy-2-oxoglutarate
    • L-4-hydroxy-2-ketoglutarate
    • (S)-2-hydroxy-4-oxopentanedioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(=O)C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.