Difference between revisions of "CPD-15016"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucosides Beta-D-glucosides] == * common name: ** a β-D glucoside * Synonym(s): =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * common name: ** (4S)-4-hy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == |
+ | * smiles: | ||
+ | ** C(C(=O)C([O-])=O)C(C([O-])=O)O | ||
* common name: | * common name: | ||
− | ** | + | ** (4S)-4-hydroxy-2-oxoglutarate |
+ | * inchi key: | ||
+ | ** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L | ||
+ | * molecular weight: | ||
+ | ** 160.083 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-4-hydroxy-2-oxoglutarate | ||
+ | ** L-4-hydroxy-2-ketoglutarate | ||
+ | ** (S)-2-hydroxy-4-oxopentanedioate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-13990]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685] | ||
+ | * METABOLIGHTS : MTBLC71685 | ||
+ | {{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}} | ||
+ | {{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}} | ||
+ | {{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}} | ||
+ | {{#set: molecular weight=160.083 }} | ||
+ | {{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}} | ||
+ | {{#set: reversible reaction associated=RXN-13990}} |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPD-15016
- smiles:
- C(C(=O)C([O-])=O)C(C([O-])=O)O
- common name:
- (4S)-4-hydroxy-2-oxoglutarate
- inchi key:
- InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
- molecular weight:
- 160.083
- Synonym(s):
- L-4-hydroxy-2-oxoglutarate
- L-4-hydroxy-2-ketoglutarate
- (S)-2-hydroxy-4-oxopentanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(=O)C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.