Difference between revisions of "CPD-15590"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13868 == * Synonym(s): == Reactions associated == * RXN-5286 ** pantograph-creinhardtii == Pathways associated == * PWY-5526...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * common name: ** aldehydo-D-ga...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == |
+ | * smiles: | ||
+ | ** [CH](=O)C(C(C(C(CO)O)O)O)O | ||
+ | * common name: | ||
+ | ** aldehydo-D-galactose | ||
+ | * inchi key: | ||
+ | ** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N | ||
+ | * molecular weight: | ||
+ | ** 180.157 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-14409]] |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556] | ||
+ | {{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}} | ||
+ | {{#set: common name=aldehydo-D-galactose}} | ||
+ | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: reversible reaction associated=RXN-14409}} |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPD-15590
- smiles:
- [CH](=O)C(C(C(C(CO)O)O)O)O
- common name:
- aldehydo-D-galactose
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.