Difference between revisions of "CPD-15590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13868 == * Synonym(s): == Reactions associated == * RXN-5286 ** pantograph-creinhardtii == Pathways associated == * PWY-5526...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * common name: ** aldehydo-D-ga...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_13868 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] ==
 +
* smiles:
 +
** [CH](=O)C(C(C(C(CO)O)O)O)O
 +
* common name:
 +
** aldehydo-D-galactose
 +
* inchi key:
 +
** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
 +
* molecular weight:
 +
** 180.157   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-5286]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[RXN-14409]]
* [[PWY-5526]]
+
* [[PWY-7758]]
+
* [[PWY-7759]]
+
* [[PWY-5064]]
+
* [[PWY-5086]]
+
* [[PWY-7760]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-5286}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-5526|PWY-7758|PWY-7759|PWY-5064|PWY-5086|PWY-7760}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556]
 +
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
 +
{{#set: common name=aldehydo-D-galactose}}
 +
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}}
 +
{{#set: molecular weight=180.157    }}
 +
{{#set: reversible reaction associated=RXN-14409}}

Latest revision as of 19:51, 21 March 2018

Metabolite CPD-15590

  • smiles:
    • [CH](=O)C(C(C(C(CO)O)O)O)O
  • common name:
    • aldehydo-D-galactose
  • inchi key:
    • InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
  • molecular weight:
    • 180.157
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.