Difference between revisions of "CPD-14675"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D19-C38-ACPs trans-D2-cis-D19-C38-ACPs] == * common name: ** a trans-delta2-cis-de...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == |
| + | * smiles: | ||
| + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** pristanoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J | ||
| + | * molecular weight: | ||
| + | ** 1043.995 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2,6,10,14-tetramethylpentadecanoyl-CoA | ||
| + | ** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A | ||
| + | ** pristanoyl-coenzyme A | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-484]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196] |
| − | {{#set: produced by= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250] | ||
| + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: common name=pristanoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}} | ||
| + | {{#set: molecular weight=1043.995 }} | ||
| + | {{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}} | ||
| + | {{#set: produced by=RXN66-484}} | ||
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPD-14675
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- pristanoyl-CoA
- inchi key:
- InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
- molecular weight:
- 1043.995
- Synonym(s):
- 2,6,10,14-tetramethylpentadecanoyl-CoA
- 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
- pristanoyl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
