Difference between revisions of "CPD-19488"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN] == * direction: ** LEFT-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == * smiles: ** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-iso...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == |
− | * | + | * smiles: |
− | ** | + | ** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** 3-isopropyl-9-(methylthio)-2-oxononanoate |
+ | * inchi key: | ||
+ | ** InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L | ||
+ | * molecular weight: | ||
+ | ** 260.304 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-18203]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-18202]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} | |
− | + | {{#set: common name=3-isopropyl-9-(methylthio)-2-oxononanoate}} | |
− | + | {{#set: inchi key=InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L}} | |
− | {{#set: | + | {{#set: molecular weight=260.304 }} |
− | {{#set: | + | {{#set: consumed by=RXN-18203}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-18202}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:51, 21 March 2018
Contents
Metabolite CPD-19488
- smiles:
- CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-isopropyl-9-(methylthio)-2-oxononanoate
- inchi key:
- InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L
- molecular weight:
- 260.304
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.