Difference between revisions of "Tiso gene 15885"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == * smiles: ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_15885 == * Synonym(s): == Reactions associated == * Reaction: RXN-15556 ** Source: annotation-in-silico_annotation *** Assignment:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] ==
+
== Gene Tiso_gene_15885 ==
* smiles:
+
** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
+
* inchi key:
+
** InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
+
* common name:
+
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
+
* molecular weight:
+
** 477.444   
+
 
* Synonym(s):
 
* Synonym(s):
** glcNAc-1,6-anhMurNAc
 
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN0-5226]]
+
* Reaction: [[RXN-15556]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-15556}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658409 90658409]
+
{{#set: pathway associated=PWY-7511}}
* BIGG : anhgm
+
{{#set: smiles=CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))}}
+
{{#set: inchi key=InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M}}
+
{{#set: common name=N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate}}
+
{{#set: molecular weight=477.444    }}
+
{{#set: common name=glcNAc-1,6-anhMurNAc|N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid}}
+
{{#set: consumed by=RXN0-5226}}
+

Latest revision as of 20:51, 21 March 2018

Gene Tiso_gene_15885

  • Synonym(s):

Reactions associated

Pathways associated

External links