Difference between revisions of "ALCD19"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCD19 ALCD19] == * direction: ** REVERSIBLE * common name: ** alcohol dehydrogenase (glycerol, NAD...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCD19 ALCD19] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
 
* common name:
 
* common name:
** pristanoyl-CoA
+
** alcohol dehydrogenase (glycerol, NAD)
* inchi key:
+
** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
+
* molecular weight:
+
** 1043.995   
+
 
* Synonym(s):
 
* Synonym(s):
** 2,6,10,14-tetramethylpentadecanoyl-CoA
 
** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
 
** pristanoyl-coenzyme A
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN66-484]]
+
** 1.0 [[GLYCERALD]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''<=>''' 1.0 [[GLYCEROL]][c] '''+''' 1.0 [[NAD]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 D-glyceraldehyde[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADH[c] '''<=>''' 1.0 glycerol[c] '''+''' 1.0 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14126]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196]
+
{{#set: common name=alcohol dehydrogenase (glycerol, NAD)}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14126}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250]
+
{{#set: in pathway=}}
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=pristanoyl-CoA}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=1043.995    }}
+
{{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}}
+
{{#set: produced by=RXN66-484}}
+

Latest revision as of 20:51, 21 March 2018

Reaction ALCD19

  • direction:
    • REVERSIBLE
  • common name:
    • alcohol dehydrogenase (glycerol, NAD)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 D-glyceraldehyde[c] + 1.0 H+[c] + 1.0 NADH[c] <=> 1.0 glycerol[c] + 1.0 NAD+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links