Difference between revisions of "2-DEHYDRO-3-DEOXY-D-GLUCONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * smiles: ** C([Se])C([N+])C([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] == * smiles: ** C(=O)([O-])C(=O)CC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(=O)([O-])C(=O)CC(O)C(O)CO |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-dehydro-3-deoxy-D-gluconate |
+ | * inchi key: | ||
+ | ** InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 177.133 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-keto-3-deoxy-D-gluconic acid |
+ | ** 2-keto-3-deoxy-D-gluconate | ||
+ | ** 3-deoxy-2-oxo-D-gluconate | ||
+ | ** 2-keto-3-deoxygluconate | ||
+ | ** 3-deoxy-D-erythro-hex-2-ulosonic acid | ||
+ | ** KDG | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MANNONDEHYDRAT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 17510-99-5 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229111 44229111] | ||
+ | * HMDB : HMDB01353 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00204 C00204] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57990 57990] |
− | * | + | * BIGG : 2ddglcn |
− | + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)CO}} | |
− | + | {{#set: common name=2-dehydro-3-deoxy-D-gluconate}} | |
− | + | {{#set: inchi key=InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M}} | |
− | {{#set: smiles=C( | + | {{#set: molecular weight=177.133 }} |
− | {{#set: | + | {{#set: common name=2-keto-3-deoxy-D-gluconic acid|2-keto-3-deoxy-D-gluconate|3-deoxy-2-oxo-D-gluconate|2-keto-3-deoxygluconate|3-deoxy-D-erythro-hex-2-ulosonic acid|KDG}} |
− | {{#set: | + | {{#set: produced by=MANNONDEHYDRAT-RXN}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: produced by= | + |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite 2-DEHYDRO-3-DEOXY-D-GLUCONATE
- smiles:
- C(=O)([O-])C(=O)CC(O)C(O)CO
- common name:
- 2-dehydro-3-deoxy-D-gluconate
- inchi key:
- InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M
- molecular weight:
- 177.133
- Synonym(s):
- 2-keto-3-deoxy-D-gluconic acid
- 2-keto-3-deoxy-D-gluconate
- 3-deoxy-2-oxo-D-gluconate
- 2-keto-3-deoxygluconate
- 3-deoxy-D-erythro-hex-2-ulosonic acid
- KDG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(O)C(O)CO" cannot be used as a page name in this wiki.