Difference between revisions of "CPD-444"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11192 == * left end position: ** 71 * transcription direction: ** POSITIVE * right end position: ** 2437 * centisome position: ** 0.8926326...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * common name: ** S-methyl-...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == |
| − | * | + | * smiles: |
| − | ** | + | ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) |
| − | * | + | * common name: |
| − | ** | + | ** S-methyl-5-thio-α-D-ribose 1-phosphate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 258.182 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 5-methylthioribose-1-phosphate | ||
| + | ** S5-methyl-5-thio-D-ribose-1-phosphate | ||
| + | ** 5-methylthio-D-ribose-1-phosphate | ||
| + | ** 5-MTR-1-P | ||
| + | ** 1-phosphomethylthioribose | ||
| + | ** 1-phospho-5-S-methylthioribose | ||
| + | ** 1-PMTR | ||
| + | ** 1-phospho-5-S-methylthio-α-D-ribofuranoside | ||
| + | ** S-methyl-5-thio-α-D-ribose 1-phosphate | ||
| + | ** S-methyl-5-thio-D-ribose 1-phosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[M5TRPI]] |
| − | + | * [[5.3.1.23-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[M5TAP]] | |
| − | * [[ | + | * [[M5TRK]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : 5mdr1p |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266677 45266677] |
| − | {{#set: | + | * HMDB : HMDB00963 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04188 C04188] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58533 58533] | ||
| + | * METABOLIGHTS : MTBLC58533 | ||
| + | {{#set: smiles=CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)}} | ||
| + | {{#set: common name=S-methyl-5-thio-α-D-ribose 1-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L}} | ||
| + | {{#set: molecular weight=258.182 }} | ||
| + | {{#set: common name=5-methylthioribose-1-phosphate|S5-methyl-5-thio-D-ribose-1-phosphate|5-methylthio-D-ribose-1-phosphate|5-MTR-1-P|1-phosphomethylthioribose|1-phospho-5-S-methylthioribose|1-PMTR|1-phospho-5-S-methylthio-α-D-ribofuranoside|S-methyl-5-thio-α-D-ribose 1-phosphate|S-methyl-5-thio-D-ribose 1-phosphate}} | ||
| + | {{#set: consumed by=M5TRPI|5.3.1.23-RXN}} | ||
| + | {{#set: produced by=M5TAP|M5TRK}} | ||
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CPD-444
- smiles:
- CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)
- common name:
- S-methyl-5-thio-α-D-ribose 1-phosphate
- inchi key:
- InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L
- molecular weight:
- 258.182
- Synonym(s):
- 5-methylthioribose-1-phosphate
- S5-methyl-5-thio-D-ribose-1-phosphate
- 5-methylthio-D-ribose-1-phosphate
- 5-MTR-1-P
- 1-phosphomethylthioribose
- 1-phospho-5-S-methylthioribose
- 1-PMTR
- 1-phospho-5-S-methylthio-α-D-ribofuranoside
- S-methyl-5-thio-α-D-ribose 1-phosphate
- S-methyl-5-thio-D-ribose 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 5mdr1p
- PUBCHEM:
- HMDB : HMDB00963
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58533
"CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)" cannot be used as a page name in this wiki.
