Difference between revisions of "14-LACTONASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] == * smiles: ** C(=O)([O-])C(=O)CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=14-LACTONASE-RXN 14-LACTONASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** gluconolacton...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=14-LACTONASE-RXN 14-LACTONASE-RXN] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C(=O)CC(O)C(O)CO
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M
+
 
* common name:
 
* common name:
−
** 2-dehydro-3-deoxy-D-gluconate
+
** gluconolactonase
−
* molecular weight:
+
* ec number:
−
** 177.133   
+
** [http://enzyme.expasy.org/EC/3.1.1.25 EC-3.1.1.25]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-keto-3-deoxy-D-gluconic acid
 
−
** 2-keto-3-deoxy-D-gluconate
 
−
** 3-deoxy-2-oxo-D-gluconate
 
−
** 2-keto-3-deoxygluconate
 
−
** 3-deoxy-D-erythro-hex-2-ulosonic acid
 
−
** KDG
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[MANNONDEHYDRAT-RXN]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-8574]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[CPD-8575]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 a 1,4-lactone[c] '''=>''' 2 H+[c] '''+''' 1 a 4-hydroxyacid[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1948]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1947]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 17510-99-5
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03708 R03708]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229111 44229111]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB01353
+
{{#set: common name=gluconolactonase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-3.1.1.25}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00204 C00204]
+
{{#set: gene associated=Tiso_gene_1948|Tiso_gene_1947}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57990 57990]
+
{{#set: reconstruction category=annotation}}
−
* BIGG : 2ddglcn
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)CO}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M}}
+
−
{{#set: common name=2-dehydro-3-deoxy-D-gluconate}}
+
−
{{#set: molecular weight=177.133    }}
+
−
{{#set: common name=2-keto-3-deoxy-D-gluconic acid|2-keto-3-deoxy-D-gluconate|3-deoxy-2-oxo-D-gluconate|2-keto-3-deoxygluconate|3-deoxy-D-erythro-hex-2-ulosonic acid|KDG}}
+
−
{{#set: produced by=MANNONDEHYDRAT-RXN}}
+

Latest revision as of 19:52, 21 March 2018

Reaction 14-LACTONASE-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • gluconolactonase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 a 1,4-lactone[c] => 2 H+[c] + 1 a 4-hydroxyacid[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=14-LACTONASE-RXN&oldid=44266"