Difference between revisions of "ITACONATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12104 == * left end position: ** 22 * transcription direction: ** NEGATIVE * right end position: ** 3222 * centisome position: ** 0.3015764...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITACONATE ITACONATE] == * smiles: ** C=C(C(=O)[O-])CC([O-])=O * common name: ** itaconate * inc...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITACONATE ITACONATE] == |
− | * | + | * smiles: |
− | ** | + | ** C=C(C(=O)[O-])CC([O-])=O |
− | * | + | * common name: |
− | ** | + | ** itaconate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LVHBHZANLOWSRM-UHFFFAOYSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 128.084 |
* Synonym(s): | * Synonym(s): | ||
+ | ** propylenedicarboxylic acid | ||
+ | ** methylenebutanedioic acid | ||
+ | ** 2-propene-1,2-dicarboxylic acid | ||
+ | ** methylenesuccinic acid | ||
+ | ** itaconic acid | ||
+ | ** 2-methylsuccinate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8988]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 97-65-4 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459996 5459996] |
− | {{#set: | + | * HMDB : HMDB02092 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00490 C00490] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573697.html 4573697] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17240 17240] | ||
+ | * METABOLIGHTS : MTBLC17240 | ||
+ | {{#set: smiles=C=C(C(=O)[O-])CC([O-])=O}} | ||
+ | {{#set: common name=itaconate}} | ||
+ | {{#set: inchi key=InChIKey=LVHBHZANLOWSRM-UHFFFAOYSA-L}} | ||
+ | {{#set: molecular weight=128.084 }} | ||
+ | {{#set: common name=propylenedicarboxylic acid|methylenebutanedioic acid|2-propene-1,2-dicarboxylic acid|methylenesuccinic acid|itaconic acid|2-methylsuccinate}} | ||
+ | {{#set: consumed by=RXN-8988}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite ITACONATE
- smiles:
- C=C(C(=O)[O-])CC([O-])=O
- common name:
- itaconate
- inchi key:
- InChIKey=LVHBHZANLOWSRM-UHFFFAOYSA-L
- molecular weight:
- 128.084
- Synonym(s):
- propylenedicarboxylic acid
- methylenebutanedioic acid
- 2-propene-1,2-dicarboxylic acid
- methylenesuccinic acid
- itaconic acid
- 2-methylsuccinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 97-65-4
- PUBCHEM:
- HMDB : HMDB02092
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17240
"C=C(C(=O)[O-])CC([O-])=O" cannot be used as a page name in this wiki.