Difference between revisions of "RXN1G-2544"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-cyclopropane-Δ1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J
+
 
* common name:
 
* common name:
−
** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA
+
** cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
−
* molecular weight:
+
* ec number:
−
** 1102.034   
+
** [http://enzyme.expasy.org/EC/2.1.1.79 EC-2.1.1.79]
 
* Synonym(s):
 
* Synonym(s):
−
** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-17113]]
+
** 1 [[cis-D19-37-MOH-38-Me-C57-1-ACPs]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[cis-19-CP-37-Mex-38-Me-C59-ACPs]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a cis-delta19-37-methoxy-38-methyl-C57:1-[acp][c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 a cis-methoxy-C59-meroacyl-[acp][c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7622]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193751 72193751]
+
{{#set: common name=cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.1.1.79}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76364 76364]
+
{{#set: gene associated=Tiso_gene_7622}}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: in pathway=PWYG-321}}
−
{{#set: inchi key=InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: molecular weight=1102.034    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA}}
+
−
{{#set: produced by=RXN-17113}}
+

Latest revision as of 20:52, 21 March 2018

Reaction RXN1G-2544

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-2544&oldid=44290"