Difference between revisions of "ALCOHOL-O-ACETYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-O-ACETYLTRANSFERASE-RXN ALCOHOL-O-ACETYLTRANSFERASE-RXN] == * direction: ** REVERSIBLE * co...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-O-ACETYLTRANSFERASE-RXN ALCOHOL-O-ACETYLTRANSFERASE-RXN] == |
| − | + | * direction: | |
| − | + | ** REVERSIBLE | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** ORF |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.84 EC-2.3.1.84] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[ACETYL-COA]][c] '''+''' 1 [[Alcohols]][c] '''<=>''' 1 [[Acetic-Esters]][c] '''+''' 1 [[CO-A]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 acetyl-CoA[c] '''+''' 1 an alcohol[c] '''<=>''' 1 an acetic ester[c] '''+''' 1 coenzyme A[c] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | Genes have been associated with this reaction based on different elements listed below. | |
| − | * [[ | + | * Gene: [[Tiso_gene_10528]] |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | * [[ | + | *** Assignment: EC-NUMBER |
| − | * | + | == Pathways == |
| − | * [[ | + | == Reconstruction information == |
| − | * [[ | + | * Category: [[annotation]] |
| − | * | + | ** Source: [[annotation-in-silico_annotation]] |
| − | * | + | *** Tool: [[pathwaytools]] |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00627 R00627] | |
| − | + | * UNIPROT: | |
| − | + | ** [http://www.uniprot.org/uniprot/Q12304 Q12304] | |
| − | + | ** [http://www.uniprot.org/uniprot/P40353 P40353] | |
| − | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=ORF}} |
| − | * | + | {{#set: ec number=EC-2.3.1.84}} |
| − | ** [http://www. | + | {{#set: gene associated=Tiso_gene_10528}} |
| − | + | {{#set: in pathway=}} | |
| − | ** [http://www. | + | {{#set: reconstruction category=annotation}} |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:52, 21 March 2018
Contents
Reaction ALCOHOL-O-ACETYLTRANSFERASE-RXN
- direction:
- REVERSIBLE
- common name:
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACETYL-COA[c] + 1 Alcohols[c] <=> 1 Acetic-Esters[c] + 1 CO-A[c]
- With common name(s):
- 1 acetyl-CoA[c] + 1 an alcohol[c] <=> 1 an acetic ester[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10528
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
