Difference between revisions of "Tiso gene 11164"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_11164 == * right end position: ** 3854 * transcription direction: ** POSITIVE * left end position: ** 2174 * centisome position: ** 27.2328...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] ==
+
== Gene Tiso_gene_11164 ==
−
* smiles:
+
* right end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 3854
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I
+
** POSITIVE
−
* common name:
+
* left end position:
−
** benzoylsuccinyl-CoA
+
** 2174
−
* molecular weight:
+
* centisome position:
−
** 966.676    
+
** 27.23287    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[OROPRIBTRANS-RXN]]
−
* [[RXN-905]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7790]]
 +
* [[PWY-7791]]
 +
* [[PWY-5686]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3854}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659089 90659089]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=2174}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28882 28882]
+
{{#set: centisome position=27.23287    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=OROPRIBTRANS-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09820 C09820]
+
{{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I}}
+
−
{{#set: common name=benzoylsuccinyl-CoA}}
+
−
{{#set: molecular weight=966.676    }}
+
−
{{#set: produced by=RXN-905}}
+

Latest revision as of 19:52, 21 March 2018

Gene Tiso_gene_11164

  • right end position:
    • 3854
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2174
  • centisome position:
    • 27.23287
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11164&oldid=44305"