Difference between revisions of "Tiso gene 16197"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
(Created page with "Category:Gene == Gene Tiso_gene_16197 == * right end position: ** 4245 * transcription direction: ** NEGATIVE * left end position: ** 3296 * centisome position: ** 73.0172...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16197 == |
− | * | + | * right end position: |
− | ** | + | ** 4245 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 3296 |
− | * | + | * centisome position: |
− | ** | + | ** 73.01728 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ADENYLYLSULFKIN-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-synechocystis]] |
− | == | + | * Reaction: [[INORGPYROPHOSPHAT-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7805]] | ||
+ | * [[PWY-7807]] | ||
+ | * [[PWY-5340]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4245}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=3296}} | |
− | + | {{#set: centisome position=73.01728 }} | |
− | + | {{#set: reaction associated=ADENYLYLSULFKIN-RXN|INORGPYROPHOSPHAT-RXN}} | |
− | + | {{#set: pathway associated=PWY-7805|PWY-7807|PWY-5340}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Gene Tiso_gene_16197
- right end position:
- 4245
- transcription direction:
- NEGATIVE
- left end position:
- 3296
- centisome position:
- 73.01728
- Synonym(s):
Reactions associated
- Reaction: ADENYLYLSULFKIN-RXN
- Source: orthology-synechocystis
- Reaction: INORGPYROPHOSPHAT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation