Difference between revisions of "CPD-11281"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17022 RXN-17022] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * common...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17022 RXN-17022] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
 
* common name:
 
* common name:
−
** 1-acylglycerol-3-phosphate_o-acyltransferase
+
** S-sulfanylglutathione
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
+
** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
 +
* molecular weight:
 +
** 338.373   
 
* Synonym(s):
 
* Synonym(s):
 +
** GSSH
 +
** glutathione-sulfide
 +
** glutathione persulfide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-18379]][c] '''+''' 1 [[Myristoyl-ACPs]][c] '''=>''' 1 [[CPD0-1425]][c] '''+''' 1 [[ACP]][c]
+
* [[RXN-15348]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 1-myristoylglycerol 3-phosphate[c] '''+''' 1 a myristoyl-[acp][c] '''=>''' 1 dimyristoyl phosphatidate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
* [[RXN-10851]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13959]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477]
−
{{#set: ec number=EC-2.3.1.51}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_13959}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905]
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=S-sulfanylglutathione}}
 +
{{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}}
 +
{{#set: molecular weight=338.373    }}
 +
{{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}}
 +
{{#set: produced by=RXN-15348}}
 +
{{#set: reversible reaction associated=RXN-10851}}

Latest revision as of 19:52, 21 March 2018

Metabolite CPD-11281

  • smiles:
    • C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
  • common name:
    • S-sulfanylglutathione
  • inchi key:
    • InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
  • molecular weight:
    • 338.373
  • Synonym(s):
    • GSSH
    • glutathione-sulfide
    • glutathione persulfide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11281&oldid=44310"