|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANSYN-RXN ANTHRANSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] |
| * common name: | | * common name: |
− | ** anthranilate_synthase | + | ** (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/4.1.3.27 EC-4.1.3.27] | + | ** InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L |
| + | * molecular weight: |
| + | ** 170.121 |
| * Synonym(s): | | * Synonym(s): |
| + | ** (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate |
| + | ** HHDD |
| + | ** (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN1K-87]] |
− | ** 1 [[CHORISMATE]][c] '''+''' 1 [[GLN]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[ANTHRANILATE]][c] '''+''' 1 [[GLT]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 chorismate[c] '''+''' 1 L-glutamine[c] '''<=>''' 1 H+[c] '''+''' 1 pyruvate[c] '''+''' 1 anthranilate[c] '''+''' 1 L-glutamate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_11176]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[TRPSYN-PWY]], L-tryptophan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY]
| + | |
− | ** '''6''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5958]], acridone alkaloid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5958 PWY-5958]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6661]], 4-hydroxy-2(1H)-quinolone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6661 PWY-6661]
| + | |
− | ** '''1''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6660]], 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6660 PWY-6660]
| + | |
− | ** '''1''' reactions found over '''9''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[athaliana]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21732 21732] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91828271 91828271] |
− | * LIGAND-RXN: | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00986 R00986] | + | ** [http://www.chemspider.com/Chemical-Structure.11531600.html 11531600] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P00897 P00897]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87504 87504] |
− | ** [http://www.uniprot.org/uniprot/P15395 P15395] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P21690 P21690] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05600 C05600] |
− | ** [http://www.uniprot.org/uniprot/P33975 P33975]
| + | {{#set: smiles=C([O-])(=O)CC=CC=C(O)C(=O)[O-]}} |
− | ** [http://www.uniprot.org/uniprot/Q9PIF4 Q9PIF4]
| + | {{#set: common name=(2Z,4Z)-2-hydroxyhepta-2,4-dienedioate}} |
− | ** [http://www.uniprot.org/uniprot/P06557 P06557] | + | {{#set: inchi key=InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L}} |
− | ** [http://www.uniprot.org/uniprot/P20463 P20463] | + | {{#set: molecular weight=170.121 }} |
− | ** [http://www.uniprot.org/uniprot/P09786 P09786]
| + | {{#set: common name=(2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate|HHDD|(2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate}} |
− | ** [http://www.uniprot.org/uniprot/Q06129 Q06129]
| + | {{#set: consumed by=RXN1K-87}} |
− | ** [http://www.uniprot.org/uniprot/P33974 P33974]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R5Z6 Q9R5Z6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58475 Q58475]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20441 P20441]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43761 P43761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57686 Q57686]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08654 Q08654]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8X3T2 Q8X3T2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20580 P20580]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08653 Q08653]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8X3T1 Q8X3T1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20579 P20579]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09785 P09785]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUS0 Q9JUS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02001 Q02001]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57690 Q57690]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9XAZ0 Q9XAZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PIF5 Q9PIF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42387 P42387]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42388 P42388]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06128 Q06128]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18267 P18267]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32068 P32068]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42565 Q42565]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20409 P20409]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14953 P14953]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03963 P03963]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00899 P00899]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00937 P00937]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00896 P00896]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00898 P00898]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00906 P00906]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00905 P00905]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00895 P00895]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00904 P00904]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00902 P00902]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00908 P00908]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00901 P00901]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00900 P00900]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14952 P14952]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05328 P05328]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06531 P06531]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23315 P23315]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25170 P25170]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30526 P30526]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32069 P32069]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24773 P24773]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02003 Q02003]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51362 P51362]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55144 Q55144]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20170 P20170]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74130 P74130]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81533 O81533]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08073 Q08073]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48261 P48261]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92370 Q92370]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S593 Q9S593]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X7C5 Q9X7C5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RQG2 Q9RQG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZFA9 Q9ZFA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41156 Q41156]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=anthranilate_synthase}} | + | |
− | {{#set: ec number=EC-4.1.3.27}} | + | |
− | {{#set: gene associated=Tiso_gene_11176}} | + | |
− | {{#set: in pathway=TRPSYN-PWY|PWY-5958|PWY-6661|PWY-6660}} | + | |
− | {{#set: reconstruction category=orthology}}
| + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=athaliana|esiliculosus}}
| + | |
− | {{#set: reconstruction category=manual}}
| + | |
− | {{#set: reconstruction source=primary_network}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=in-silico_annotation}} | + | |