Difference between revisions of "CPD-5662"

Latest revision as of 19:52, 21 March 2018

"C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_12946 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
+* smiles:
+** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
+* common name:
+** 9-mercaptodethiobiotin
+* inchi key:
+** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
+* molecular weight:
+** 245.316
 * Synonym(s):
+** 9-mercaptodesthiobiotin
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[3.5.1.98-RXN]]
+* [[RXN-17473]]
-** [[pantograph]]-[[esiliculosus]]
+== Reaction(s) known to produce the compound ==
-== Pathways associated ==
+* [[RXN-17472]]
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: reaction associated=3.5.1.98-RXN}}
+* PUBCHEM:
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092]
+{{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}}
+{{#set: common name=9-mercaptodethiobiotin}}
+{{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}}
+{{#set: molecular weight=245.316    }}
+{{#set: common name=9-mercaptodesthiobiotin}}
+{{#set: consumed by=RXN-17473}}
+{{#set: produced by=RXN-17472}}