Difference between revisions of "CPD-7524"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 7,9,9'-cis-neurosporene |
| + | * inchi key: | ||
| + | ** InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 538.898 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** proneurosporene |
| + | ** 7,9,9'-tri-cis-neurosporene | ||
| + | ** 7,9,9'-tricis-neurosporene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11357]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11356]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19759 C19759] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62463 62463] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244751 25244751] |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}} |
| − | {{#set: common name= | + | {{#set: common name=7,9,9'-cis-neurosporene}} |
| − | {{#set: consumed | + | {{#set: inchi key=InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N}} |
| + | {{#set: molecular weight=538.898 }} | ||
| + | {{#set: common name=proneurosporene|7,9,9'-tri-cis-neurosporene|7,9,9'-tricis-neurosporene}} | ||
| + | {{#set: consumed by=RXN-11357}} | ||
| + | {{#set: produced by=RXN-11356}} | ||
Latest revision as of 20:52, 21 March 2018
Contents
Metabolite CPD-7524
- smiles:
- CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
- common name:
- 7,9,9'-cis-neurosporene
- inchi key:
- InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
- molecular weight:
- 538.898
- Synonym(s):
- proneurosporene
- 7,9,9'-tri-cis-neurosporene
- 7,9,9'-tricis-neurosporene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
