Difference between revisions of "INDOXYL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14452 == * right end position: ** 4969 * transcription direction: ** POSITIVE * left end position: ** 4261 * centisome position: ** 75.4426...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * common name: ** indoxyl * inchi k...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_14452 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] ==
−
* right end position:
+
* smiles:
−
** 4969
+
** C2(C=CC1(=C(C(O)=CN1)C=2))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** indoxyl
−
* left end position:
+
* inchi key:
−
** 4261
+
** InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
−
* centisome position:
+
* molecular weight:
−
** 75.442635    
+
** 133.149    
 
* Synonym(s):
 
* Synonym(s):
 +
** indole-3-ol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[RXN-15556]]
+
== Reaction(s) known to produce the compound ==
−
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Assignment: automated-name-match
+
* [[RXN-15587]]
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: right end position=4969}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50591 50591]
−
{{#set: left end position=4261}}
+
* CHEMSPIDER:
−
{{#set: centisome position=75.442635   }}
+
** [http://www.chemspider.com/Chemical-Structure.45861.html 45861]
−
{{#set: reaction associated=RXN-15556}}
+
* HMDB : HMDB04094
−
{{#set: pathway associated=PWY-7511}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17840 17840]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05658 C05658]
 +
{{#set: smiles=C2(C=CC1(=C(C(O)=CN1)C=2))}}
 +
{{#set: common name=indoxyl}}
 +
{{#set: inchi key=InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=133.149   }}
 +
{{#set: common name=indole-3-ol}}
 +
{{#set: reversible reaction associated=RXN-15587}}

Latest revision as of 19:52, 21 March 2018

Metabolite INDOXYL

  • smiles:
    • C2(C=CC1(=C(C(O)=CN1)C=2))
  • common name:
    • indoxyl
  • inchi key:
    • InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
  • molecular weight:
    • 133.149
  • Synonym(s):
    • indole-3-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=INDOXYL&oldid=44331"