Difference between revisions of "INDOXYL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13299 RXN-13299] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * common name: ** indoxyl * inchi k...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13299 RXN-13299] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C2(C=CC1(=C(C(O)=CN1)C=2))
 
* common name:
 
* common name:
−
** chloroplast_beta-keto_acyl_reductase
+
** indoxyl
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
+
** InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 133.149   
 
* Synonym(s):
 
* Synonym(s):
 +
** indole-3-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-10283]][c] '''=>''' 1 [[CPD-14276]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-15587]]
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 3-oxo-behenoyl-CoA[c] '''=>''' 1 (3R)-3-hydroxy-behenoyl-CoA[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9871]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
−
** '''16''' reactions found over '''16''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50591 50591]
−
{{#set: ec number=EC-1.1.1.330}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_9871}}
+
** [http://www.chemspider.com/Chemical-Structure.45861.html 45861]
−
{{#set: in pathway=PWY-7036}}
+
* HMDB : HMDB04094
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17840 17840]
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05658 C05658]
 +
{{#set: smiles=C2(C=CC1(=C(C(O)=CN1)C=2))}}
 +
{{#set: common name=indoxyl}}
 +
{{#set: inchi key=InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=133.149    }}
 +
{{#set: common name=indole-3-ol}}
 +
{{#set: reversible reaction associated=RXN-15587}}

Latest revision as of 19:52, 21 March 2018

Metabolite INDOXYL

  • smiles:
    • C2(C=CC1(=C(C(O)=CN1)C=2))
  • common name:
    • indoxyl
  • inchi key:
    • InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
  • molecular weight:
    • 133.149
  • Synonym(s):
    • indole-3-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=INDOXYL&oldid=44331"