Difference between revisions of "RXN-14208"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * inchi...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14208 RXN-14208] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14208 RXN-14208] ==
−
* smiles:
+
* direction:
−
** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** apigenin
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 269.233   
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
 
* Synonym(s):
 
* Synonym(s):
−
** 4',5,7-trihydroxyflavone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7651]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[WATER]][c] '''+''' 1 [[DGTP]][c] '''=>''' 2 [[Pi]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[DGMP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 H2O[c] '''+''' 1 dGTP[c] '''=>''' 2 phosphate[c] '''+''' 2 H+[c] '''+''' 1 dGMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 520-36-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIPID_MAPS : LMPK12110005
+
{{#set: common name=ORF}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.6.1.5}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200950 25200950]
+
{{#set: gene associated=Tiso_gene_12899|Tiso_gene_20236}}
−
* HMDB : HMDB02124
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01477 C01477]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58470 58470]
+
−
{{#set: smiles=C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))}}
+
−
{{#set: inchi key=InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M}}
+
−
{{#set: common name=apigenin}}
+
−
{{#set: molecular weight=269.233    }}
+
−
{{#set: common name=4',5,7-trihydroxyflavone}}
+
−
{{#set: consumed by=RXN-7651}}
+

Latest revision as of 20:52, 21 March 2018

Reaction RXN-14208

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 H2O[c] + 1 dGTP[c] => 2 phosphate[c] + 2 H+[c] + 1 dGMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14208&oldid=44332"