Difference between revisions of "INDOLE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATP_3h_th ATP_3h_th] == * direction: ** LEFT-TO-RIGHT * common name: ** ADP/ATP transporter, chloro...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * smiles: ** C2(C=CC1(=C(C=CN1)C=2)) * common name: ** indole * inchi key: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == |
− | * | + | * smiles: |
− | ** | + | ** C2(C=CC1(=C(C=CN1)C=2)) |
* common name: | * common name: | ||
− | ** | + | ** indole |
+ | * inchi key: | ||
+ | ** InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 117.15 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-2382]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-2381]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 120-72-9 | |
− | {{#set: | + | * DRUGBANK : DB04532 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=798 798] |
− | {{#set: | + | * HMDB : HMDB00738 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00463 C00463] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.776.html 776] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16881 16881] | ||
+ | * BIGG : indole | ||
+ | {{#set: smiles=C2(C=CC1(=C(C=CN1)C=2))}} | ||
+ | {{#set: common name=indole}} | ||
+ | {{#set: inchi key=InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=117.15 }} | ||
+ | {{#set: consumed by=RXN0-2382}} | ||
+ | {{#set: reversible reaction associated=RXN0-2381}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite INDOLE
- smiles:
- C2(C=CC1(=C(C=CN1)C=2))
- common name:
- indole
- inchi key:
- InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N
- molecular weight:
- 117.15
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 120-72-9
- DRUGBANK : DB04532
- PUBCHEM:
- HMDB : HMDB00738
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : indole