Difference between revisions of "NAD-KIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * common name:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAD-KIN-RXN NAD-KIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** diacylglycerol_kinase_c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAD-KIN-RXN NAD-KIN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** diacylglycerol_kinase_catalytic_region |
− | * | + | ** diacylglycerol_kinase |
− | ** | + | ** sphingosine_kinase_1 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.23 EC-2.7.1.23] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NAD+[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 NADP+[c] '''+''' 1 H+[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_1163]] |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14560]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_1420]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5083]], NAD/NADH phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5083 PWY-5083] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[NADPHOS-DEPHOS-PWY-1]], NAD phosphorylation and transhydrogenation: [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY-1 NADPHOS-DEPHOS-PWY-1] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-7268]], NAD/NADP-NADH/NADPH cytosolic interconversion (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7268 PWY-7268] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-7269]], NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7269 PWY-7269] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[NADPHOS-DEPHOS-PWY]], NAD phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY NADPHOS-DEPHOS-PWY] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18629 18629] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00104 R00104] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=diacylglycerol_kinase_catalytic_region}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=diacylglycerol_kinase}} |
− | + | {{#set: common name=sphingosine_kinase_1}} | |
− | + | {{#set: ec number=EC-2.7.1.23}} | |
− | + | {{#set: gene associated=Tiso_gene_1163|Tiso_gene_14560|Tiso_gene_1420}} | |
− | + | {{#set: in pathway=PWY-5083|NADPHOS-DEPHOS-PWY-1|PWY-7268|PWY-7269|NADPHOS-DEPHOS-PWY}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:53, 21 March 2018
Contents
Reaction NAD-KIN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- diacylglycerol_kinase_catalytic_region
- diacylglycerol_kinase
- sphingosine_kinase_1
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 ATP[c] => 1 ADP[c] + 1 NADP+[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1163
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14560
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1420
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-5083, NAD/NADH phosphorylation and dephosphorylation: PWY-5083
- 3 reactions found over 6 reactions in the full pathway
- NADPHOS-DEPHOS-PWY-1, NAD phosphorylation and transhydrogenation: NADPHOS-DEPHOS-PWY-1
- 1 reactions found over 2 reactions in the full pathway
- PWY-7268, NAD/NADP-NADH/NADPH cytosolic interconversion (yeast): PWY-7268
- 4 reactions found over 5 reactions in the full pathway
- PWY-7269, NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast): PWY-7269
- 4 reactions found over 5 reactions in the full pathway
- NADPHOS-DEPHOS-PWY, NAD phosphorylation and dephosphorylation: NADPHOS-DEPHOS-PWY
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links