Difference between revisions of "DHRT ibcoa"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] == * smiles: ** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_ibcoa DHRT_ibcoa] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrolipoyllysine-resid...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_ibcoa DHRT_ibcoa] ==
* smiles:
+
* direction:
** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J
+
 
* common name:
 
* common name:
** (9Z)-tetradecenoyl-CoA
+
** dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, Isobutyryl-CoA forming
* molecular weight:
+
** 971.845   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-16561]]
+
** 1.0 [[CPD-281]][m] '''+''' 1.0 [[CO-A]][m] '''=>''' 1.0 [[DIHYDROLIPOAMIDE]][m] '''+''' 1.0 [[ISOBUTYRYL-COA]][m]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 S-(2-methylpropanoyl)-dihydrolipoamide[m] '''+''' 1.0 coenzyme A[m] '''=>''' 1.0 dihydrolipoamide[m] '''+''' 1.0 isobutanoyl-CoA[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11793]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678739 70678739]
+
{{#set: common name=dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, Isobutyryl-CoA forming}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_11793}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65060 65060]
+
{{#set: in pathway=}}
{{#set: smiles=CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: common name=(9Z)-tetradecenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=971.845    }}
+
{{#set: produced by=RXN-16561}}
+

Latest revision as of 20:53, 21 March 2018

Reaction DHRT_ibcoa

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, Isobutyryl-CoA forming
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 S-(2-methylpropanoyl)-dihydrolipoamide[m] + 1.0 coenzyme A[m] => 1.0 dihydrolipoamide[m] + 1.0 isobutanoyl-CoA[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links