Difference between revisions of "Tiso gene 18224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] == * smiles: ** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_18224 == * right end position: ** 2780 * transcription direction: ** NEGATIVE * left end position: ** 791 * centisome position: ** 25.03164...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] ==
+
== Gene Tiso_gene_18224 ==
−
* smiles:
+
* right end position:
−
** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2780
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** (9Z)-tetradecenoyl-CoA
+
** 791
−
* molecular weight:
+
* centisome position:
−
** 971.845    
+
** 25.031645    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CDPKIN-RXN]]
−
* [[RXN-16561]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[DADPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[DCDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[DGDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[DTDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[DUDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[GDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14120]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14228]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[UDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-7176]]
 +
* [[PWY-7220]]
 +
* [[PWY-7184]]
 +
* [[PWY-7222]]
 +
* [[PWY-7205]]
 +
* [[PWY-7224]]
 +
* [[PWY-7197]]
 +
* [[PWY0-166]]
 +
* [[PWY-7227]]
 +
* [[PPGPPMET-PWY]]
 +
* [[PWY-7226]]
 +
* [[PWY-7221]]
 +
* [[PWY-6545]]
 +
* [[PWY-7187]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2780}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678739 70678739]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=791}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65060 65060]
+
{{#set: centisome position=25.031645   }}
−
{{#set: smiles=CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=CDPKIN-RXN|DADPKIN-RXN|DCDPKIN-RXN|DGDPKIN-RXN|DTDPKIN-RXN|DUDPKIN-RXN|GDPKIN-RXN|NUCLEOSIDE-DIP-KIN-RXN|RXN-14120|RXN-14228|UDPKIN-RXN}}
−
{{#set: inchi key=InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J}}
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7176|PWY-7220|PWY-7184|PWY-7222|PWY-7205|PWY-7224|PWY-7197|PWY0-166|PWY-7227|PPGPPMET-PWY|PWY-7226|PWY-7221|PWY-6545|PWY-7187}}
−
{{#set: common name=(9Z)-tetradecenoyl-CoA}}
+
−
{{#set: molecular weight=971.845   }}
+
−
{{#set: produced by=RXN-16561}}
+

Latest revision as of 19:53, 21 March 2018

Gene Tiso_gene_18224

  • right end position:
    • 2780
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 791
  • centisome position:
    • 25.031645
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18224&oldid=44379"