Difference between revisions of "AMINO-PARATHION"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ANXANor ANXANor] == * direction: ** LEFT-TO-RIGHT * common name: ** antheraxanthin,NADH:oxygen oxid...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * common name:...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S |
* common name: | * common name: | ||
| − | ** | + | ** amino-parathion |
| + | * inchi key: | ||
| + | ** InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 261.275 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[AMINOPARATHION-PHOSPHATASE-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=220 220] | |
| − | {{#set: | + | * HMDB : HMDB01504 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06605 C06605] |
| − | {{#set: | + | {{#set: smiles=CCOP(OC1(C=CC(=CC=1)N))(OCC)=S}} |
| − | {{#set: | + | {{#set: common name=amino-parathion}} |
| + | {{#set: inchi key=InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=261.275 }} | ||
| + | {{#set: consumed by=AMINOPARATHION-PHOSPHATASE-RXN}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite AMINO-PARATHION
- smiles:
- CCOP(OC1(C=CC(=CC=1)N))(OCC)=S
- common name:
- amino-parathion
- inchi key:
- InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N
- molecular weight:
- 261.275
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
