Difference between revisions of "CPD-1834"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] == * direction: ** LEFT-TO-RIGHT * common name: ** xyloglucan XLXG oligosaccha...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
 
* common name:
 
* common name:
−
** xyloglucan XLXG oligosaccharide β-galactosidase
+
** (25R)-3α,7α-dihydroxy-5-β-cholestanate
−
** glycoside_hydrolase
+
* inchi key:
−
** polyprotein
+
** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.2.1.23 EC-3.2.1.23]
+
** 433.65   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-α,7-α-dihydroxy-5-β-cholestanoate
 +
** 3-α,7-α-dihydroxy-5-β-cholestanate
 +
** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-13377]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-13375]][c] '''+''' 1 [[D-galactopyranose]][c]
+
* [[RXN-9844]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 XLXG xyloglucan oligosaccharide[c] '''+''' 1 H2O[c] '''=>''' 1 XXXG xyloglucan oligosaccharide[c] '''+''' 1 D-galactopyranose[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_17558]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_1398]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_12839]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6807]], xyloglucan degradation II (exoglucanase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6807 PWY-6807]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=xyloglucan XLXG oligosaccharide β-galactosidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753]
−
{{#set: common name=glycoside_hydrolase}}
+
* CHEBI:
−
{{#set: common name=polyprotein}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750]
−
{{#set: ec number=EC-3.2.1.23}}
+
* LIGAND-CPD:
−
{{#set: gene associated=Tiso_gene_17558|Tiso_gene_1398|Tiso_gene_12839}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554]
−
{{#set: in pathway=PWY-6807}}
+
{{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: molecular weight=433.65    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN-9844}}
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite CPD-1834

  • smiles:
    • CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
  • common name:
    • (25R)-3α,7α-dihydroxy-5-β-cholestanate
  • inchi key:
    • InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
  • molecular weight:
    • 433.65
  • Synonym(s):
    • 3-α,7-α-dihydroxy-5-β-cholestanoate
    • 3-α,7-α-dihydroxy-5-β-cholestanate
    • (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-1834&oldid=44397"