Difference between revisions of "RXN-15212"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15212 RXN-15212] == * direction: ** LEFT-TO-RIGHT * common name: ** sphingomyelinase * ec numbe...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15212 RXN-15212] ==
* smiles:
+
* direction:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N
+
 
* common name:
 
* common name:
** teasterone
+
** sphingomyelinase
* molecular weight:
+
* ec number:
** 448.685   
+
** [http://enzyme.expasy.org/EC/3.1.4.12 EC-3.1.4.12]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-717]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[N-acyl-sphingosylphosphorylcholine]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[N-Acylsphingosine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PHOSPHORYL-CHOLINE]][c]
* [[RXN-716]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 an N-acyl-sphingosylphosphorylcholine[c] '''+''' 1 H2O[c] '''=>''' 1 a sphingosine ceramide[c] '''+''' 1 H+[c] '''+''' 1 phosphocholine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12644]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7277]], sphingolipid biosynthesis (mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7277 PWY-7277]
 +
** '''5''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY3DJ-11281]], sphingomyelin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13475125 13475125]
+
{{#set: common name=sphingomyelinase}}
* CHEBI:
+
{{#set: ec number=EC-3.1.4.12}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=26863 26863]
+
{{#set: gene associated=Tiso_gene_12644}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7277|PWY3DJ-11281}}
** [http://www.genome.jp/dbget-bin/www_bget?C15791 C15791]
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: inchi key=InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=teasterone}}
+
{{#set: molecular weight=448.685    }}
+
{{#set: consumed by=RXN-717}}
+
{{#set: produced by=RXN-716}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXN-15212

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • sphingomyelinase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7277, sphingolipid biosynthesis (mammals): PWY-7277
    • 5 reactions found over 7 reactions in the full pathway
  • PWY3DJ-11281, sphingomyelin metabolism: PWY3DJ-11281
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links