Difference between revisions of "RXN-4209"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4209 RXN-4209] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4209 RXN-4209] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 2 [[FERROCYTOCHROME-B5]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[CPD-4125]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-4126]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] |
| − | == | + | * With common name(s): |
| − | == | + | ** 2 a ferrocytochrome b5[c] '''+''' 2 H+[c] '''+''' 1 avenasterol[c] '''+''' 1 oxygen[c] '''=>''' 1 5-dehydroavenasterol[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| + | * Gene: [[Tiso_gene_5446]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | == Pathways == | ||
| + | * [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541] | ||
| + | ** '''10''' reactions found over '''36''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07486 R07486] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.14.19.20}} | |
| − | + | {{#set: gene associated=Tiso_gene_5446}} | |
| − | * LIGAND- | + | {{#set: in pathway=PWY-2541}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
| − | + | {{#set: reconstruction source=orthology-athaliana}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:53, 21 March 2018
Contents
Reaction RXN-4209
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 FERROCYTOCHROME-B5[c] + 2 PROTON[c] + 1 CPD-4125[c] + 1 OXYGEN-MOLECULE[c] => 1 CPD-4126[c] + 2 FERRICYTOCHROME-B5[c] + 2 WATER[c]
- With common name(s):
- 2 a ferrocytochrome b5[c] + 2 H+[c] + 1 avenasterol[c] + 1 oxygen[c] => 1 5-dehydroavenasterol[c] + 2 a ferricytochrome b5[c] + 2 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5446
- Source: orthology-athaliana
Pathways
- PWY-2541, plant sterol biosynthesis: PWY-2541
- 10 reactions found over 36 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
External links
- LIGAND-RXN:
