Difference between revisions of "Tiso gene 10320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) * inchi k...") |
(Created page with "Category:Gene == Gene Tiso_gene_10320 == * right end position: ** 1677 * transcription direction: ** POSITIVE * left end position: ** 3 * centisome position: ** 3.47262440...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10320 == |
− | * | + | * right end position: |
− | ** | + | ** 1677 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3 |
− | * | + | * centisome position: |
− | ** | + | ** 3.472624400e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-12610]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-12611]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[THI-P-SYN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6907]] | ||
+ | * [[PWY-6908]] | ||
+ | * [[PWY-7357]] | ||
+ | * [[PWY-6894]] | ||
+ | * [[PWY-6897]] | ||
+ | * [[PWY-7356]] | ||
+ | * [[PWY-6893]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1677}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3}} | |
− | + | {{#set: centisome position=3.472624400e-2}} | |
− | + | {{#set: reaction associated=RXN-12610|RXN-12611|THI-P-SYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6907|PWY-6908|PWY-7357|PWY-6894|PWY-6897|PWY-7356|PWY-6893}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:53, 21 March 2018
Gene Tiso_gene_10320
- right end position:
- 1677
- transcription direction:
- POSITIVE
- left end position:
- 3
- centisome position:
- 3.472624400e-2
- Synonym(s):
Reactions associated
- Reaction: RXN-12610
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12611
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: THI-P-SYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation