Difference between revisions of "RXN-16648"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) * inchi k...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16648 RXN-16648] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16648 RXN-16648] ==
−
* smiles:
+
* direction:
−
** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=SUYJZKRQHBQNCA-LSDHHAIUSA-M
+
** [http://enzyme.expasy.org/EC/2.4.1.336 EC-2.4.1.336]
−
* common name:
+
−
** (+)-pinobanksin
+
−
* molecular weight:
+
−
** 271.249   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2R,3R)-pinobanksin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-7648]]
+
** 1 [[CPD-12575]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[D-Glucosyl-12-diacyl-glycerols]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 UDP-α-D-glucose[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] '''=>''' 1 UDP[c] '''+''' 1 H+[c] '''+''' 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6390]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_322]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
* [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817]
 +
** '''7''' reactions found over '''16''' reactions in the full pathway
 +
* [[PWY-7666]], galactolipid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7666 PWY-7666]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09826 C09826]
+
{{#set: ec number=EC-2.4.1.336}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_6390|Tiso_gene_322}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28103 28103]
+
{{#set: in pathway=PWY-7817|PWY-7666}}
−
* METABOLIGHTS : MTBLC28103
+
{{#set: reconstruction category=orthology}}
−
* PUBCHEM:
+
{{#set: reconstruction source=orthology-synechocystis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200970 25200970]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB37506
+
−
{{#set: smiles=C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3)}}
+
−
{{#set: inchi key=InChIKey=SUYJZKRQHBQNCA-LSDHHAIUSA-M}}
+
−
{{#set: common name=(+)-pinobanksin}}
+
−
{{#set: molecular weight=271.249    }}
+
−
{{#set: common name=(2R,3R)-pinobanksin}}
+
−
{{#set: produced by=RXN-7648}}
+

Latest revision as of 20:53, 21 March 2018

Reaction RXN-16648

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7817, type I lipoteichoic acid biosynthesis (S. aureus): PWY-7817
    • 7 reactions found over 16 reactions in the full pathway
  • PWY-7666, galactolipid biosynthesis II: PWY-7666
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16648&oldid=44434"