Difference between revisions of "RXN-16648"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16648 RXN-16648] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16648 RXN-16648] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.4.1.336 EC-2.4.1.336] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-12575]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[D-Glucosyl-12-diacyl-glycerols]][c] |
− | == | + | * With common name(s): |
+ | ** 1 UDP-α-D-glucose[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] '''=>''' 1 UDP[c] '''+''' 1 H+[c] '''+''' 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6390]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Gene: [[Tiso_gene_322]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817] | ||
+ | ** '''7''' reactions found over '''16''' reactions in the full pathway | ||
+ | * [[PWY-7666]], galactolipid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7666 PWY-7666] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.4.1.336}} | |
− | + | {{#set: gene associated=Tiso_gene_6390|Tiso_gene_322}} | |
− | + | {{#set: in pathway=PWY-7817|PWY-7666}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-synechocystis}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:53, 21 March 2018
Contents
Reaction RXN-16648
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-12575[c] + 1 DIACYLGLYCEROL[c] => 1 UDP[c] + 1 PROTON[c] + 1 D-Glucosyl-12-diacyl-glycerols[c]
- With common name(s):
- 1 UDP-α-D-glucose[c] + 1 a 1,2-diacyl-sn-glycerol[c] => 1 UDP[c] + 1 H+[c] + 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6390
- Source: orthology-synechocystis
- Gene: Tiso_gene_322
- Source: orthology-synechocystis
Pathways
- PWY-7817, type I lipoteichoic acid biosynthesis (S. aureus): PWY-7817
- 7 reactions found over 16 reactions in the full pathway
- PWY-7666, galactolipid biosynthesis II: PWY-7666
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis