Difference between revisions of "CPD-4101"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10586 CPD-10586] == * smiles: ** CC(CO)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
| − | ** | + | ** 24-methylenelophenol |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 412.698 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4α-methyl-5α-ergosta-7,24-dien-3β-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.1.1.143-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=CC( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522] |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=24-methylenelophenol}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=412.698 }} |
| + | {{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}} | ||
| + | {{#set: consumed by=2.1.1.143-RXN}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-4101
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 24-methylenelophenol
- inchi key:
- InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
- molecular weight:
- 412.698
- Synonym(s):
- 4α-methyl-5α-ergosta-7,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
