Difference between revisions of "CPD-4101"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIS5-ADENOSYL-TRIPHOSPHATASE-RXN BIS5-ADENOSYL-TRIPHOSPHATASE-RXN] == * direction: ** LEFT-TO-RIGHT...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * common name: |
− | ** | + | ** 24-methylenelophenol |
+ | * inchi key: | ||
+ | ** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N | ||
+ | * molecular weight: | ||
+ | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4α-methyl-5α-ergosta-7,24-dien-3β-ol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[2.1.1.143-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640] |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107] |
− | {{#set: | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522] | |
− | {{#set: | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: | + | {{#set: common name=24-methylenelophenol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}} |
− | {{#set: | + | {{#set: molecular weight=412.698 }} |
− | {{#set: | + | {{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}} |
+ | {{#set: consumed by=2.1.1.143-RXN}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-4101
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 24-methylenelophenol
- inchi key:
- InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
- molecular weight:
- 412.698
- Synonym(s):
- 4α-methyl-5α-ergosta-7,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.