Difference between revisions of "Tiso gene 819"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * inchi key: ** InChIKey=I...")
 
(Created page with "Category:Gene == Gene Tiso_gene_819 == * right end position: ** 25643 * transcription direction: ** POSITIVE * left end position: ** 24077 * centisome position: ** 84.2383...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] ==
+
== Gene Tiso_gene_819 ==
−
* smiles:
+
* right end position:
−
** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
+
** 25643
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** α-D-xylose 1-phosphate
+
** 24077
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 84.238335    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ACSERLY-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[2.7.7.11-RXN]]
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12726]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[SULFOCYS-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[CYSTSYN-PWY]]
 +
* [[PWY-6936]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=25643}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202995 25202995]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=24077}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559]
+
{{#set: centisome position=84.238335    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ACSERLY-RXN|RXN-12726|SULFOCYS-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737]
+
{{#set: pathway associated=CYSTSYN-PWY|PWY-6936}}
−
{{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L}}
+
−
{{#set: common name=α-D-xylose 1-phosphate}}
+
−
{{#set: molecular weight=228.095    }}
+
−
{{#set: consumed or produced by=2.7.7.11-RXN}}
+

Latest revision as of 20:54, 21 March 2018

Gene Tiso_gene_819

  • right end position:
    • 25643
  • transcription direction:
    • POSITIVE
  • left end position:
    • 24077
  • centisome position:
    • 84.238335
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_819&oldid=44481"