Difference between revisions of "Tiso gene 819"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * inchi key: ** InChIKey=I...") |
(Created page with "Category:Gene == Gene Tiso_gene_819 == * right end position: ** 25643 * transcription direction: ** POSITIVE * left end position: ** 24077 * centisome position: ** 84.2383...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_819 == |
− | * | + | * right end position: |
− | ** | + | ** 25643 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 24077 |
− | * | + | * centisome position: |
− | ** | + | ** 84.238335 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ACSERLY-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12726]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[SULFOCYS-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[CYSTSYN-PWY]] | ||
+ | * [[PWY-6936]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=25643}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=24077}} | |
− | + | {{#set: centisome position=84.238335 }} | |
− | + | {{#set: reaction associated=ACSERLY-RXN|RXN-12726|SULFOCYS-RXN}} | |
− | + | {{#set: pathway associated=CYSTSYN-PWY|PWY-6936}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:54, 21 March 2018
Gene Tiso_gene_819
- right end position:
- 25643
- transcription direction:
- POSITIVE
- left end position:
- 24077
- centisome position:
- 84.238335
- Synonym(s):
Reactions associated
- Reaction: ACSERLY-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12726
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: SULFOCYS-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation