Difference between revisions of "CPD0-2354"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] == * common name: ** a tRNA precursor with a 5' extension * Synonym(s): =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] ==
* smiles:
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
+
* inchi key:
+
** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
+
 
* common name:
 
* common name:
** maltoheptaose
+
** a tRNA precursor with a 5' extension
* molecular weight:
+
** 1153.009   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14286]]
+
* [[RXN0-6480]]
* [[RXN-14283]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-4222]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a tRNA precursor with a 5' extension}}
** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689]
+
{{#set: consumed by=RXN0-6480}}
* CHEBI:
+
{{#set: produced by=RXN0-4222}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954]
+
* METABOLIGHTS : MTBLC61954
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996]
+
* BIGG : malthp
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}}
+
{{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}}
+
{{#set: common name=maltoheptaose}}
+
{{#set: molecular weight=1153.009    }}
+
{{#set: consumed by=RXN-14286|RXN-14283}}
+

Latest revision as of 20:54, 21 March 2018

Metabolite CPD0-2354

  • common name:
    • a tRNA precursor with a 5' extension
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links