Difference between revisions of "RXN-16626"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16626 RXN-16626] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16626 RXN-16626] ==
* smiles:
+
* direction:
** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** maltoheptaose
+
** 3-oxoacyl-(acyl-carrier-protein)
* inchi key:
+
* ec number:
** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
* molecular weight:
+
** 1153.009   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14286]]
+
* With identifiers:
* [[RXN-14283]]
+
** 1 [[NADPH]][c] '''+''' 1 [[9Z-3-oxo-octadec-9-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 NADPH[c] '''+''' 1 a (9Z)-3-oxo-octadec-9-enoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R,9Z)-3-hydroxy-octadec-9-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9885]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
 +
** '''10''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689]
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
* CHEBI:
+
{{#set: ec number=EC-1.1.1.100}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954]
+
{{#set: gene associated=Tiso_gene_9885|Tiso_gene_13083}}
* METABOLIGHTS : MTBLC61954
+
{{#set: in pathway=PWY-7664}}
* BIGG : malthp
+
{{#set: reconstruction category=annotation}}
* PUBCHEM:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996]
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}}
+
{{#set: common name=maltoheptaose}}
+
{{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}}
+
{{#set: molecular weight=1153.009    }}
+
{{#set: consumed by=RXN-14286|RXN-14283}}
+

Latest revision as of 20:54, 21 March 2018

Reaction RXN-16626

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-(acyl-carrier-protein)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
    • 10 reactions found over 14 reactions in the full pathway

Reconstruction information

External links