Difference between revisions of "Tiso gene 6675"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * inchi key: ** InChIKey=I...")
(Created page with "Category:Gene == Gene Tiso_gene_6675 == * right end position: ** 8416 * transcription direction: ** POSITIVE * left end position: ** 6956 * centisome position: ** 58.2482...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] ==
+
== Gene Tiso_gene_6675 ==
−
* smiles:
+
* right end position:
−
** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
+
** 8416
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** α-D-xylose 1-phosphate
+
** 6956
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 58.2482    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.1.1.39-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[2.7.7.11-RXN]]
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[MALIC-NADP-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-3641]]
 +
* [[GLUCONEO-PWY]]
 +
* [[PWY-7384]]
 +
* [[PWY-7686]]
 +
* [[PWY-7117]]
 +
* [[PWY-7115]]
 +
* [[PWY-7118]]
 +
* [[PWY-241]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8416}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202995 25202995]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=6956}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559]
+
{{#set: centisome position=58.2482   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=1.1.1.39-RXN|MALIC-NADP-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737]
+
{{#set: pathway associated=PWY-3641|GLUCONEO-PWY|PWY-7384|PWY-7686|PWY-7117|PWY-7115|PWY-7118|PWY-241}}
−
{{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L}}
+
−
{{#set: common name=α-D-xylose 1-phosphate}}
+
−
{{#set: molecular weight=228.095   }}
+
−
{{#set: consumed or produced by=2.7.7.11-RXN}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_6675

  • right end position:
    • 8416
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6956
  • centisome position:
    • 58.2482
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6675&oldid=44532"