Difference between revisions of "CPD1F-4"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * com...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) |
* common name: | * common name: | ||
| − | ** | + | ** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 382.542 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** C25-allenic-apo-aldehyde |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-698]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596] |
| − | * | + | * LIGAND-CPD: |
| − | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044] |
| − | {{#set: smiles=CC( | + | {{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}} |
| − | {{#set: common name= | + | {{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=382.542 }} |
| − | {{#set: common name= | + | {{#set: common name=C25-allenic-apo-aldehyde}} |
| − | {{#set: produced by= | + | {{#set: produced by=RXN-698}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD1F-4
- smiles:
- CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
- common name:
- (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
- inchi key:
- InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
- molecular weight:
- 382.542
- Synonym(s):
- C25-allenic-apo-aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
