Difference between revisions of "RXN-13297"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13297 RXN-13297] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13297 RXN-13297] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[MALONYL-COA]][c] '''+''' 1 [[CPD-10279]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-14273]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 malonyl-CoA[c] '''+''' 1 docosanoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 3-oxo-lignoceroyl-CoA[c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] | ||
+ | ** '''16''' reactions found over '''16''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.3.1.199}} | |
− | + | {{#set: in pathway=PWY-7036}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:54, 21 March 2018
Contents
Reaction RXN-13297
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MALONYL-COA[c] + 1 CPD-10279[c] + 1 PROTON[c] => 1 CPD-14273[c] + 1 CO-A[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 malonyl-CoA[c] + 1 docosanoyl-CoA[c] + 1 H+[c] => 1 3-oxo-lignoceroyl-CoA[c] + 1 coenzyme A[c] + 1 CO2[c]
Genes associated with this reaction
Pathways
- PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
- 16 reactions found over 16 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation