Difference between revisions of "CPD-420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14281 CPD-14281] == * smiles: ** CCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-420 CPD-420] == * smiles: ** CC(NC(C(=O)[O-])CC(=O)[O-])=O * common name: ** N-acetyl-L-asp...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-420 CPD-420] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(NC(C(=O)[O-])CC(=O)[O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-L-aspartate |
+ | * inchi key: | ||
+ | ** InChIKey=OTCCIMWXFLJLIA-BYPYZUCNSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 173.125 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N-acetyl-α-L-aspartate |
− | ** | + | ** N-acetyl-L-aspartic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-13680]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2042020 2042020] |
+ | * HMDB : HMDB00812 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01042 C01042] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.1539206.html 1539206] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16953 16953] |
− | {{#set: smiles | + | * METABOLIGHTS : MTBLC16953 |
− | {{#set: | + | {{#set: smiles=CC(NC(C(=O)[O-])CC(=O)[O-])=O}} |
− | {{#set: | + | {{#set: common name=N-acetyl-L-aspartate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=OTCCIMWXFLJLIA-BYPYZUCNSA-L}} |
− | {{#set: common name= | + | {{#set: molecular weight=173.125 }} |
− | + | {{#set: common name=N-acetyl-α-L-aspartate|N-acetyl-L-aspartic acid}} | |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-13680}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-420
- smiles:
- CC(NC(C(=O)[O-])CC(=O)[O-])=O
- common name:
- N-acetyl-L-aspartate
- inchi key:
- InChIKey=OTCCIMWXFLJLIA-BYPYZUCNSA-L
- molecular weight:
- 173.125
- Synonym(s):
- N-acetyl-α-L-aspartate
- N-acetyl-L-aspartic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB00812
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16953
"CC(NC(C(=O)[O-])CC(=O)[O-])=O" cannot be used as a page name in this wiki.