Difference between revisions of "Tiso gene 19787"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_19787 == * right end position: ** 146 * transcription direction: ** POSITIVE * left end position: ** 2 * centisome position: ** 9.82318300e...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_19787 == |
| − | * | + | * right end position: |
| − | ** | + | ** 146 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 2 |
| − | * | + | * centisome position: |
| − | ** | + | ** 9.82318300e-2 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | == | + | *** Assignment: ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=146}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=2}} |
| − | {{#set: | + | {{#set: centisome position=9.82318300e-2}} |
| − | {{#set: | + | {{#set: reaction associated=RNA-DIRECTED-DNA-POLYMERASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:54, 21 March 2018
Gene Tiso_gene_19787
- right end position:
- 146
- transcription direction:
- POSITIVE
- left end position:
- 2
- centisome position:
- 9.82318300e-2
- Synonym(s):
Reactions associated
- Reaction: RNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
